C12H18N2O5S — CID 99988211
2-(ethylamino)-5-(3-hydroxypropylsulfamoyl)benzoic acid (PubChem CID 99988211) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-(ethylamino)-5-(3-hydroxypropylsulfamoyl)benzoic acid.
| Compound Name | 2-(ethylamino)-5-(3-hydroxypropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99988211 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-(ethylamino)-5-(3-hydroxypropylsulfamoyl)benzoic acid |
| SMILES | CCNc1ccc(S(=O)(=O)NCCCO)cc1C(=O)O |
| InChI | InChI=1S/C12H18N2O5S/c1-2-13-11-5-4-9(8-10(11)12(16)17)20(18,19)14-6-3-7-15/h4-5,8,13-15H,2-3,6-7H2,1H3,(H,16,17) |
| InChIKey | PKVNYUPOVSERPI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|