C18H22N2O5S — CID 99983704
5-(3-hydroxypropylsulfamoyl)-2-(2-phenylethylamino)benzoic acid (PubChem CID 99983704) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 5-(3-hydroxypropylsulfamoyl)-2-(2-phenylethylamino)benzoic acid.
| Compound Name | 5-(3-hydroxypropylsulfamoyl)-2-(2-phenylethylamino)benzoic acid |
|---|---|
| PubChem CID | 99983704 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 5-(3-hydroxypropylsulfamoyl)-2-(2-phenylethylamino)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCCCO)ccc1NCCc1ccccc1 |
| InChI | InChI=1S/C18H22N2O5S/c21-12-4-10-20-26(24,25)15-7-8-17(16(13-15)18(22)23)19-11-9-14-5-2-1-3-6-14/h1-3,5-8,13,19-21H,4,9-12H2,(H,22,23) |
| InChIKey | MXNGLRFVHAOJDG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|