C23H28N2O4S — CID 99983404
5-[2-(cyclohexen-1-yl)ethylsulfamoyl]-2-(2-phenylethylamino)benzoic acid (PubChem CID 99983404) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is 5-[2-(cyclohexen-1-yl)ethylsulfamoyl]-2-(2-phenylethylamino)benzoic acid.
| Compound Name | 5-[2-(cyclohexen-1-yl)ethylsulfamoyl]-2-(2-phenylethylamino)benzoic acid |
|---|---|
| PubChem CID | 99983404 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 5-[2-(cyclohexen-1-yl)ethylsulfamoyl]-2-(2-phenylethylamino)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCCC2=CCCCC2)ccc1NCCc1ccccc1 |
| InChI | InChI=1S/C23H28N2O4S/c26-23(27)21-17-20(30(28,29)25-16-14-19-9-5-2-6-10-19)11-12-22(21)24-15-13-18-7-3-1-4-8-18/h1,3-4,7-9,11-12,17,24-25H,2,5-6,10,13-16H2,(H,26,27) |
| InChIKey | YRXQBKAZSXTBTJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|