C18H26N2O4S — CID 99981613
2-[2-(cyclohexen-1-yl)ethylamino]-5-(propylsulfamoyl)benzoic acid (PubChem CID 99981613) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethylamino]-5-(propylsulfamoyl)benzoic acid.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethylamino]-5-(propylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99981613 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethylamino]-5-(propylsulfamoyl)benzoic acid |
| SMILES | CCCNS(=O)(=O)c1ccc(NCCC2=CCCCC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H26N2O4S/c1-2-11-20-25(23,24)15-8-9-17(16(13-15)18(21)22)19-12-10-14-6-4-3-5-7-14/h6,8-9,13,19-20H,2-5,7,10-12H2,1H3,(H,21,22) |
| InChIKey | ZCJXOAZSQAPSPH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|