C17H24N2O5S — CID 99978619
4-[2-(cyclohexen-1-yl)ethylamino]-3-(2-hydroxyethylsulfamoyl)benzoic acid (PubChem CID 99978619) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-[2-(cyclohexen-1-yl)ethylamino]-3-(2-hydroxyethylsulfamoyl)benzoic acid.
| Compound Name | 4-[2-(cyclohexen-1-yl)ethylamino]-3-(2-hydroxyethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99978619 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 4-[2-(cyclohexen-1-yl)ethylamino]-3-(2-hydroxyethylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1ccc(NCCC2=CCCCC2)c(S(=O)(=O)NCCO)c1 |
| InChI | InChI=1S/C17H24N2O5S/c20-11-10-19-25(23,24)16-12-14(17(21)22)6-7-15(16)18-9-8-13-4-2-1-3-5-13/h4,6-7,12,18-20H,1-3,5,8-11H2,(H,21,22) |
| InChIKey | KNOJPOVYBZKJQL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|