C11H16N2O5S — CID 99977266
3-(ethylsulfamoyl)-4-(2-hydroxyethylamino)benzoic acid (PubChem CID 99977266) has the molecular formula C11H16N2O5S and a molecular weight of 288.33 g/mol. Its IUPAC name is 3-(ethylsulfamoyl)-4-(2-hydroxyethylamino)benzoic acid.
| Compound Name | 3-(ethylsulfamoyl)-4-(2-hydroxyethylamino)benzoic acid |
|---|---|
| PubChem CID | 99977266 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-(ethylsulfamoyl)-4-(2-hydroxyethylamino)benzoic acid |
| SMILES | CCNS(=O)(=O)c1cc(C(=O)O)ccc1NCCO |
| InChI | InChI=1S/C11H16N2O5S/c1-2-13-19(17,18)10-7-8(11(15)16)3-4-9(10)12-5-6-14/h3-4,7,12-14H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | QXUNPRBUCADTIE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |