C17H20N2O5S — CID 99978634
3-(2-hydroxyethylsulfamoyl)-4-[[(1R)-1-phenylethyl]amino]benzoic acid (PubChem CID 99978634) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 3-(2-hydroxyethylsulfamoyl)-4-[[(1R)-1-phenylethyl]amino]benzoic acid.
| Compound Name | 3-(2-hydroxyethylsulfamoyl)-4-[[(1R)-1-phenylethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 99978634 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-(2-hydroxyethylsulfamoyl)-4-[[(1R)-1-phenylethyl]amino]benzoic acid |
| SMILES | C[C@@H](Nc1ccc(C(=O)O)cc1S(=O)(=O)NCCO)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-12(13-5-3-2-4-6-13)19-15-8-7-14(17(21)22)11-16(15)25(23,24)18-9-10-20/h2-8,11-12,18-20H,9-10H2,1H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | FXIQASVKXXJSSF-GFCCVEGCSA-N |
| XLogP | 1.83 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |