C23H28N2O4S — CID 99978536
3-[2-(cyclohexen-1-yl)ethylsulfamoyl]-4-[[(1R)-1-phenylethyl]amino]benzoic acid (PubChem CID 99978536) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethylsulfamoyl]-4-[[(1R)-1-phenylethyl]amino]benzoic acid.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethylsulfamoyl]-4-[[(1R)-1-phenylethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 99978536 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethylsulfamoyl]-4-[[(1R)-1-phenylethyl]amino]benzoic acid |
| SMILES | C[C@@H](Nc1ccc(C(=O)O)cc1S(=O)(=O)NCCC1=CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O4S/c1-17(19-10-6-3-7-11-19)25-21-13-12-20(23(26)27)16-22(21)30(28,29)24-15-14-18-8-4-2-5-9-18/h3,6-8,10-13,16-17,24-25H,2,4-5,9,14-15H2,1H3,(H,26,27)/t17-/m1/s1 |
| InChIKey | IJYJSJIZOSVAJF-QGZVFWFLSA-N |
| XLogP | 4.73 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|