C14H16BrNO4S — CID 106168036
4-bromo-3-[2-(cyclopenten-1-yl)ethylsulfamoyl]benzoic acid (PubChem CID 106168036) has the molecular formula C14H16BrNO4S and a molecular weight of 374.26 g/mol. Its IUPAC name is 4-bromo-3-[2-(cyclopenten-1-yl)ethylsulfamoyl]benzoic acid.
| Compound Name | 4-bromo-3-[2-(cyclopenten-1-yl)ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 106168036 |
| Molecular Formula | C14H16BrNO4S |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 4-bromo-3-[2-(cyclopenten-1-yl)ethylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Br)c(S(=O)(=O)NCCC2=CCCC2)c1 |
| InChI | InChI=1S/C14H16BrNO4S/c15-12-6-5-11(14(17)18)9-13(12)21(19,20)16-8-7-10-3-1-2-4-10/h3,5-6,9,16H,1-2,4,7-8H2,(H,17,18) |
| InChIKey | LWAGJRDSZPPRKK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|