C13H15BrClNO2S — CID 106174188
3-bromo-4-chloro-N-[2-(cyclopenten-1-yl)ethyl]benzenesulfonamide (PubChem CID 106174188) has the molecular formula C13H15BrClNO2S and a molecular weight of 364.69 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[2-(cyclopenten-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-bromo-4-chloro-N-[2-(cyclopenten-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106174188 |
| Molecular Formula | C13H15BrClNO2S |
| Molecular Weight | 364.69 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 3-bromo-4-chloro-N-[2-(cyclopenten-1-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCC1=CCCC1)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C13H15BrClNO2S/c14-12-9-11(5-6-13(12)15)19(17,18)16-8-7-10-3-1-2-4-10/h3,5-6,9,16H,1-2,4,7-8H2 |
| InChIKey | MBICRDHTVOVHAE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.69 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|