C9H9BrClNO4S — CID 106605107
3-[(3-bromo-4-chlorophenyl)sulfonylamino]propanoic acid (PubChem CID 106605107) has the molecular formula C9H9BrClNO4S and a molecular weight of 342.60 g/mol. Its IUPAC name is 3-[(3-bromo-4-chlorophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(3-bromo-4-chlorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 106605107 |
| Molecular Formula | C9H9BrClNO4S |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 340.91 |
| IUPAC Name | 3-[(3-bromo-4-chlorophenyl)sulfonylamino]propanoic acid |
| SMILES | O=C(O)CCNS(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C9H9BrClNO4S/c10-7-5-6(1-2-8(7)11)17(15,16)12-4-3-9(13)14/h1-2,5,12H,3-4H2,(H,13,14) |
| InChIKey | CSHFZZQNPQXFEC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |