C11H11BrClNO6S — CID 106605240
2-[(3-bromo-4-chlorophenyl)sulfonylamino]pentanedioic acid (PubChem CID 106605240) has the molecular formula C11H11BrClNO6S and a molecular weight of 400.63 g/mol. Its IUPAC name is 2-[(3-bromo-4-chlorophenyl)sulfonylamino]pentanedioic acid.
| Compound Name | 2-[(3-bromo-4-chlorophenyl)sulfonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 106605240 |
| Molecular Formula | C11H11BrClNO6S |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 398.92 |
| IUPAC Name | 2-[(3-bromo-4-chlorophenyl)sulfonylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NS(=O)(=O)c1ccc(Cl)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C11H11BrClNO6S/c12-7-5-6(1-2-8(7)13)21(19,20)14-9(11(17)18)3-4-10(15)16/h1-2,5,9,14H,3-4H2,(H,15,16)(H,17,18) |
| InChIKey | JASLAABJIPJPJJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |