C11H11BrClNO6S — CID 106605388
(2S)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]-4-methoxy-4-oxobutanoic acid (PubChem CID 106605388) has the molecular formula C11H11BrClNO6S and a molecular weight of 400.63 g/mol. Its IUPAC name is (2S)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 106605388 |
| Molecular Formula | C11H11BrClNO6S |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 398.92 |
| IUPAC Name | (2S)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NS(=O)(=O)c1ccc(Cl)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C11H11BrClNO6S/c1-20-10(15)5-9(11(16)17)14-21(18,19)6-2-3-8(13)7(12)4-6/h2-4,9,14H,5H2,1H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | HPQDTCHFWCKWLK-VIFPVBQESA-N |
| XLogP | 1.40 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |