C12H15BrClNO4S — CID 106605293
(2S)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]-3,3-dimethylbutanoic acid (PubChem CID 106605293) has the molecular formula C12H15BrClNO4S and a molecular weight of 384.68 g/mol. Its IUPAC name is (2S)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 106605293 |
| Molecular Formula | C12H15BrClNO4S |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | (2S)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@H](NS(=O)(=O)c1ccc(Cl)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C12H15BrClNO4S/c1-12(2,3)10(11(16)17)15-20(18,19)7-4-5-9(14)8(13)6-7/h4-6,10,15H,1-3H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | WKPQARYLJRDZBD-SNVBAGLBSA-N |
| XLogP | 2.88 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |