(2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid

C12H17NO4S — CID 61142132

IUPAC(2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid
SMILESCC(C)(C)[C@H](NS(=O)(=O)c1ccccc1)C(=O)O
InChIInChI=1S/C12H17NO4S/c1-12(2,3)10(11(14)15)13-18(16,17)9-7-5-4-6-8-9/h4-8,10,13H,1-3H3,(H,14,15)/t10-/m1/s1
InChIKeyGCUOOKTXVXTNPT-SNVBAGLBSA-N
MW271.34 g/mol
LogP1.46
Rot. Bonds4

About (2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid

(2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid (PubChem CID 61142132) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid.

Molecular Properties

Compound Name(2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid
PubChem CID61142132
Molecular FormulaC12H17NO4S
Molecular Weight271.34 g/mol
Exact Mass271.09
IUPAC Name(2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid
SMILESCC(C)(C)[C@H](NS(=O)(=O)c1ccccc1)C(=O)O
InChIInChI=1S/C12H17NO4S/c1-12(2,3)10(11(14)15)13-18(16,17)9-7-5-4-6-8-9/h4-8,10,13H,1-3H3,(H,14,15)/t10-/m1/s1
InChIKeyGCUOOKTXVXTNPT-SNVBAGLBSA-N
XLogP1.46
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.34
LogP ≤ 51.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid?
The IUPAC name of (2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid (CID 61142132) is (2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid.
What is the SMILES notation for (2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid?
The canonical SMILES for (2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid is CC(C)(C)[C@H](NS(=O)(=O)c1ccccc1)C(=O)O.
What is the InChIKey of (2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid?
The InChIKey is GCUOOKTXVXTNPT-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H17NO4S/c1-12(2,3)10(11(14)15)13-18(16,17)9-7-5-4-6-8-9/h4-8,10,13H,1-3H3,(H,14,15)/t10-/m1/s1.
What are the key properties of (2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid?
(2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid has a molecular weight of 271.34 g/mol, XLogP of 1.46, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(benzenesulfonamido)-3,3-dimethylbutanoic acid is sourced from PubChem (CID 61142132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).