C12H16INO4S — CID 43468127
2-[(4-iodophenyl)sulfonylamino]-3,3-dimethylbutanoic acid (PubChem CID 43468127) has the molecular formula C12H16INO4S and a molecular weight of 397.23 g/mol. Its IUPAC name is 2-[(4-iodophenyl)sulfonylamino]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(4-iodophenyl)sulfonylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 43468127 |
| Molecular Formula | C12H16INO4S |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 2-[(4-iodophenyl)sulfonylamino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(NS(=O)(=O)c1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C12H16INO4S/c1-12(2,3)10(11(15)16)14-19(17,18)9-6-4-8(13)5-7-9/h4-7,10,14H,1-3H3,(H,15,16) |
| InChIKey | DITBGAQRILVNMI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|