C12H14INO6S — CID 82781112
2-[(4-iodophenyl)sulfonylamino]-5-methoxy-5-oxopentanoic acid (PubChem CID 82781112) has the molecular formula C12H14INO6S and a molecular weight of 427.22 g/mol. Its IUPAC name is 2-[(4-iodophenyl)sulfonylamino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | 2-[(4-iodophenyl)sulfonylamino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 82781112 |
| Molecular Formula | C12H14INO6S |
| Molecular Weight | 427.22 g/mol |
| Exact Mass | 426.96 |
| IUPAC Name | 2-[(4-iodophenyl)sulfonylamino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CCC(NS(=O)(=O)c1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C12H14INO6S/c1-20-11(15)7-6-10(12(16)17)14-21(18,19)9-4-2-8(13)3-5-9/h2-5,10,14H,6-7H2,1H3,(H,16,17) |
| InChIKey | RVLLBXNQHIQXBY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|