C12H16ClIN2O6S — CID 174417184
3-amino-2-[(4-iodophenyl)sulfonylamino]propanoic acid;ethyl carbonochloridate (PubChem CID 174417184) has the molecular formula C12H16ClIN2O6S and a molecular weight of 478.69 g/mol. Its IUPAC name is 3-amino-2-[(4-iodophenyl)sulfonylamino]propanoic acid;ethyl carbonochloridate.
| Compound Name | 3-amino-2-[(4-iodophenyl)sulfonylamino]propanoic acid;ethyl carbonochloridate |
|---|---|
| PubChem CID | 174417184 |
| Molecular Formula | C12H16ClIN2O6S |
| Molecular Weight | 478.69 g/mol |
| Exact Mass | 477.95 |
| IUPAC Name | 3-amino-2-[(4-iodophenyl)sulfonylamino]propanoic acid;ethyl carbonochloridate |
| SMILES | CCOC(=O)Cl.NCC(NS(=O)(=O)c1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C9H11IN2O4S.C3H5ClO2/c10-6-1-3-7(4-2-6)17(15,16)12-8(5-11)9(13)14;1-2-6-3(4)5/h1-4,8,12H,5,11H2,(H,13,14);2H2,1H3 |
| InChIKey | YYEWKELVOQFWER-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.69 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|