C13H20N2O5S — CID 54072667
3-amino-2-[(4-butoxyphenyl)sulfonylamino]propanoic acid (PubChem CID 54072667) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is 3-amino-2-[(4-butoxyphenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-amino-2-[(4-butoxyphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 54072667 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3-amino-2-[(4-butoxyphenyl)sulfonylamino]propanoic acid |
| SMILES | CCCCOc1ccc(S(=O)(=O)NC(CN)C(=O)O)cc1 |
| InChI | InChI=1S/C13H20N2O5S/c1-2-3-8-20-10-4-6-11(7-5-10)21(18,19)15-12(9-14)13(16)17/h4-7,12,15H,2-3,8-9,14H2,1H3,(H,16,17) |
| InChIKey | MHOFBBFRKKVVHL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|