C15H23NO5S — CID 18801854
2-[(4-ethoxyphenyl)sulfonylamino]-5-methylhexanoic acid (PubChem CID 18801854) has the molecular formula C15H23NO5S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)sulfonylamino]-5-methylhexanoic acid.
| Compound Name | 2-[(4-ethoxyphenyl)sulfonylamino]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 18801854 |
| Molecular Formula | C15H23NO5S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-[(4-ethoxyphenyl)sulfonylamino]-5-methylhexanoic acid |
| SMILES | CCOc1ccc(S(=O)(=O)NC(CCC(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C15H23NO5S/c1-4-21-12-6-8-13(9-7-12)22(19,20)16-14(15(17)18)10-5-11(2)3/h6-9,11,14,16H,4-5,10H2,1-3H3,(H,17,18) |
| InChIKey | LMGOAHOIDLYDEB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |