C12H17NO6S — CID 104935293
(2S,3R)-2-[(4-ethoxyphenyl)sulfonylamino]-3-hydroxybutanoic acid (PubChem CID 104935293) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is (2S,3R)-2-[(4-ethoxyphenyl)sulfonylamino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[(4-ethoxyphenyl)sulfonylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104935293 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (2S,3R)-2-[(4-ethoxyphenyl)sulfonylamino]-3-hydroxybutanoic acid |
| SMILES | CCOc1ccc(S(=O)(=O)N[C@H](C(=O)O)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C12H17NO6S/c1-3-19-9-4-6-10(7-5-9)20(17,18)13-11(8(2)14)12(15)16/h4-8,11,13-14H,3H2,1-2H3,(H,15,16)/t8-,11+/m1/s1 |
| InChIKey | VDGDJUHKKOASIL-KCJUWKMLSA-N |
| XLogP | 0.20 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |