C11H14NO6S- — CID 2104038
(2R,3S)-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanoate (PubChem CID 2104038) has the molecular formula C11H14NO6S- and a molecular weight of 288.30 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanoate.
| Compound Name | (2R,3S)-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 2104038 |
| Molecular Formula | C11H14NO6S- |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanoate |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C(=O)[O-])[C@H](C)O)cc1 |
| InChI | InChI=1S/C11H15NO6S/c1-7(13)10(11(14)15)12-19(16,17)9-5-3-8(18-2)4-6-9/h3-7,10,12-13H,1-2H3,(H,14,15)/p-1/t7-,10+/m0/s1 |
| InChIKey | VJAHSOIECXJUPQ-OIBJUYFYSA-M |
| XLogP | -1.53 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |