C11H16N2O6S — CID 50907085
(2R,3S)-N,3-dihydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanamide (PubChem CID 50907085) has the molecular formula C11H16N2O6S and a molecular weight of 304.32 g/mol. Its IUPAC name is (2R,3S)-N,3-dihydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanamide.
| Compound Name | (2R,3S)-N,3-dihydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 50907085 |
| Molecular Formula | C11H16N2O6S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2R,3S)-N,3-dihydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C(=O)NO)[C@H](C)O)cc1 |
| InChI | InChI=1S/C11H16N2O6S/c1-7(14)10(11(15)12-16)13-20(17,18)9-5-3-8(19-2)4-6-9/h3-7,10,13-14,16H,1-2H3,(H,12,15)/t7-,10+/m0/s1 |
| InChIKey | YNIHTMMJQXUNPE-OIBJUYFYSA-N |
| XLogP | -0.77 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|