C19H22BrNO5S — CID 16578703
(4-methoxyphenyl)methyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 16578703) has the molecular formula C19H22BrNO5S and a molecular weight of 456.36 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | (4-methoxyphenyl)methyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 16578703 |
| Molecular Formula | C19H22BrNO5S |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | COc1ccc(COC(=O)[C@@H](NS(=O)(=O)c2ccc(Br)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C19H22BrNO5S/c1-13(2)18(21-27(23,24)17-10-6-15(20)7-11-17)19(22)26-12-14-4-8-16(25-3)9-5-14/h4-11,13,18,21H,12H2,1-3H3/t18-/m0/s1 |
| InChIKey | PPRJINRKENHSTO-SFHVURJKSA-N |
| XLogP | 3.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |