C15H22BrNO4S — CID 54389295
tert-butyl 2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 54389295) has the molecular formula C15H22BrNO4S and a molecular weight of 392.32 g/mol. Its IUPAC name is tert-butyl 2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | tert-butyl 2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 54389295 |
| Molecular Formula | C15H22BrNO4S |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | tert-butyl 2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(Br)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22BrNO4S/c1-10(2)13(14(18)21-15(3,4)5)17-22(19,20)12-8-6-11(16)7-9-12/h6-10,13,17H,1-5H3 |
| InChIKey | VFMGXRFRRDTHNX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |