C15H20BrNO4S — CID 51969937
2-methylprop-2-enyl (2R)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 51969937) has the molecular formula C15H20BrNO4S and a molecular weight of 390.30 g/mol. Its IUPAC name is 2-methylprop-2-enyl (2R)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | 2-methylprop-2-enyl (2R)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 51969937 |
| Molecular Formula | C15H20BrNO4S |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 2-methylprop-2-enyl (2R)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | C=C(C)COC(=O)[C@H](NS(=O)(=O)c1ccc(Br)cc1)C(C)C |
| InChI | InChI=1S/C15H20BrNO4S/c1-10(2)9-21-15(18)14(11(3)4)17-22(19,20)13-7-5-12(16)6-8-13/h5-8,11,14,17H,1,9H2,2-4H3/t14-/m1/s1 |
| InChIKey | GXLANQFOUIRUON-CQSZACIVSA-N |
| XLogP | 2.87 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|