C14H18ClNO5S — CID 7567919
2-oxopropyl (2S)-2-[(4-chlorophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 7567919) has the molecular formula C14H18ClNO5S and a molecular weight of 347.82 g/mol. Its IUPAC name is 2-oxopropyl (2S)-2-[(4-chlorophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | 2-oxopropyl (2S)-2-[(4-chlorophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7567919 |
| Molecular Formula | C14H18ClNO5S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-oxopropyl (2S)-2-[(4-chlorophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CC(=O)COC(=O)[C@@H](NS(=O)(=O)c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C14H18ClNO5S/c1-9(2)13(14(18)21-8-10(3)17)16-22(19,20)12-6-4-11(15)5-7-12/h4-7,9,13,16H,8H2,1-3H3/t13-/m0/s1 |
| InChIKey | WXUZNAPHDHUDJQ-ZDUSSCGKSA-N |
| XLogP | 1.78 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |