C16H23ClN2O5S — CID 5026119
[2-oxo-2-(propylamino)ethyl] 2-[(4-chlorophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 5026119) has the molecular formula C16H23ClN2O5S and a molecular weight of 390.89 g/mol. Its IUPAC name is [2-oxo-2-(propylamino)ethyl] 2-[(4-chlorophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | [2-oxo-2-(propylamino)ethyl] 2-[(4-chlorophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 5026119 |
| Molecular Formula | C16H23ClN2O5S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [2-oxo-2-(propylamino)ethyl] 2-[(4-chlorophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CCCNC(=O)COC(=O)C(NS(=O)(=O)c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C16H23ClN2O5S/c1-4-9-18-14(20)10-24-16(21)15(11(2)3)19-25(22,23)13-7-5-12(17)6-8-13/h5-8,11,15,19H,4,9-10H2,1-3H3,(H,18,20) |
| InChIKey | SICABDFBOLSLNA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |