C17H25N3O6S — CID 4687481
[2-oxo-2-(propylcarbamoylamino)ethyl] 2-(benzenesulfonamido)-3-methylbutanoate (PubChem CID 4687481) has the molecular formula C17H25N3O6S and a molecular weight of 399.47 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] 2-(benzenesulfonamido)-3-methylbutanoate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-(benzenesulfonamido)-3-methylbutanoate |
|---|---|
| PubChem CID | 4687481 |
| Molecular Formula | C17H25N3O6S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-(benzenesulfonamido)-3-methylbutanoate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)C(NS(=O)(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C17H25N3O6S/c1-4-10-18-17(23)19-14(21)11-26-16(22)15(12(2)3)20-27(24,25)13-8-6-5-7-9-13/h5-9,12,15,20H,4,10-11H2,1-3H3,(H2,18,19,21,23) |
| InChIKey | CCTFXIWFZOOAQZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |