C17H25N3O6S2 — CID 55324138
[2-oxo-2-(propylcarbamoylamino)ethyl] 2-(benzenesulfonamido)-4-methylsulfanylbutanoate (PubChem CID 55324138) has the molecular formula C17H25N3O6S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] 2-(benzenesulfonamido)-4-methylsulfanylbutanoate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-(benzenesulfonamido)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 55324138 |
| Molecular Formula | C17H25N3O6S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-(benzenesulfonamido)-4-methylsulfanylbutanoate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)C(CCSC)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H25N3O6S2/c1-3-10-18-17(23)19-15(21)12-26-16(22)14(9-11-27-2)20-28(24,25)13-7-5-4-6-8-13/h4-8,14,20H,3,9-12H2,1-2H3,(H2,18,19,21,23) |
| InChIKey | DEGWRHSXFCCILQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |