C16H22N2O5S2 — CID 7982765
[2-(cyclopropylamino)-2-oxoethyl] (2S)-2-(benzenesulfonamido)-4-methylsulfanylbutanoate (PubChem CID 7982765) has the molecular formula C16H22N2O5S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] (2S)-2-(benzenesulfonamido)-4-methylsulfanylbutanoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] (2S)-2-(benzenesulfonamido)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7982765 |
| Molecular Formula | C16H22N2O5S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] (2S)-2-(benzenesulfonamido)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NS(=O)(=O)c1ccccc1)C(=O)OCC(=O)NC1CC1 |
| InChI | InChI=1S/C16H22N2O5S2/c1-24-10-9-14(16(20)23-11-15(19)17-12-7-8-12)18-25(21,22)13-5-3-2-4-6-13/h2-6,12,14,18H,7-11H2,1H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | AOUXGPRPZPKBPR-AWEZNQCLSA-N |
| XLogP | 0.91 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |