C18H28N2O3S2 — CID 112760371
2-(benzenesulfonamido)-N-cyclohexyl-N-methyl-4-methylsulfanylbutanamide (PubChem CID 112760371) has the molecular formula C18H28N2O3S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-cyclohexyl-N-methyl-4-methylsulfanylbutanamide.
| Compound Name | 2-(benzenesulfonamido)-N-cyclohexyl-N-methyl-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 112760371 |
| Molecular Formula | C18H28N2O3S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-(benzenesulfonamido)-N-cyclohexyl-N-methyl-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccccc1)C(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C18H28N2O3S2/c1-20(15-9-5-3-6-10-15)18(21)17(13-14-24-2)19-25(22,23)16-11-7-4-8-12-16/h4,7-8,11-12,15,17,19H,3,5-6,9-10,13-14H2,1-2H3 |
| InChIKey | ZHEYUJWSWLKNTJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |