C15H24N2O3S2 — CID 51149693
2-(benzenesulfonamido)-N,N-diethyl-4-methylsulfanylbutanamide (PubChem CID 51149693) has the molecular formula C15H24N2O3S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N,N-diethyl-4-methylsulfanylbutanamide.
| Compound Name | 2-(benzenesulfonamido)-N,N-diethyl-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 51149693 |
| Molecular Formula | C15H24N2O3S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-(benzenesulfonamido)-N,N-diethyl-4-methylsulfanylbutanamide |
| SMILES | CCN(CC)C(=O)C(CCSC)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H24N2O3S2/c1-4-17(5-2)15(18)14(11-12-21-3)16-22(19,20)13-9-7-6-8-10-13/h6-10,14,16H,4-5,11-12H2,1-3H3 |
| InChIKey | ZFEJSDRGQYBWMP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |