C18H23N3O5S3 — CID 26709302
(2S)-2-(benzenesulfonamido)-4-methylsulfanyl-N-[(4-sulfamoylphenyl)methyl]butanamide (PubChem CID 26709302) has the molecular formula C18H23N3O5S3 and a molecular weight of 457.60 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-4-methylsulfanyl-N-[(4-sulfamoylphenyl)methyl]butanamide.
| Compound Name | (2S)-2-(benzenesulfonamido)-4-methylsulfanyl-N-[(4-sulfamoylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 26709302 |
| Molecular Formula | C18H23N3O5S3 |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-4-methylsulfanyl-N-[(4-sulfamoylphenyl)methyl]butanamide |
| SMILES | CSCC[C@H](NS(=O)(=O)c1ccccc1)C(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H23N3O5S3/c1-27-12-11-17(21-29(25,26)16-5-3-2-4-6-16)18(22)20-13-14-7-9-15(10-8-14)28(19,23)24/h2-10,17,21H,11-13H2,1H3,(H,20,22)(H2,19,23,24)/t17-/m0/s1 |
| InChIKey | FAYCRQUBEQZGJG-KRWDZBQOSA-N |
| XLogP | 1.05 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |