C20H26N2O5S2 — CID 55343823
2-(benzenesulfonamido)-N-[2-(2-methoxyphenoxy)ethyl]-4-methylsulfanylbutanamide (PubChem CID 55343823) has the molecular formula C20H26N2O5S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[2-(2-methoxyphenoxy)ethyl]-4-methylsulfanylbutanamide.
| Compound Name | 2-(benzenesulfonamido)-N-[2-(2-methoxyphenoxy)ethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 55343823 |
| Molecular Formula | C20H26N2O5S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[2-(2-methoxyphenoxy)ethyl]-4-methylsulfanylbutanamide |
| SMILES | COc1ccccc1OCCNC(=O)C(CCSC)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O5S2/c1-26-18-10-6-7-11-19(18)27-14-13-21-20(23)17(12-15-28-2)22-29(24,25)16-8-4-3-5-9-16/h3-11,17,22H,12-15H2,1-2H3,(H,21,23) |
| InChIKey | XKWCXGBEEULVDK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|