C17H21N3O4S2 — CID 40713383
(2S)-2-(benzenesulfonamido)-N-(6-methoxy-3-pyridinyl)-4-methylsulfanylbutanamide (PubChem CID 40713383) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-N-(6-methoxy-3-pyridinyl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-(benzenesulfonamido)-N-(6-methoxy-3-pyridinyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 40713383 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-N-(6-methoxy-3-pyridinyl)-4-methylsulfanylbutanamide |
| SMILES | COc1ccc(NC(=O)[C@H](CCSC)NS(=O)(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-24-16-9-8-13(12-18-16)19-17(21)15(10-11-25-2)20-26(22,23)14-6-4-3-5-7-14/h3-9,12,15,20H,10-11H2,1-2H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | GXBIENLKTMDGBX-HNNXBMFYSA-N |
| XLogP | 2.13 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |