C21H28N2O6S2 — CID 55626826
2-(benzenesulfonamido)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-methylsulfanylbutanamide (PubChem CID 55626826) has the molecular formula C21H28N2O6S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-methylsulfanylbutanamide.
| Compound Name | 2-(benzenesulfonamido)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 55626826 |
| Molecular Formula | C21H28N2O6S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-methylsulfanylbutanamide |
| SMILES | COCCOc1cc(NC(=O)C(CCSC)NS(=O)(=O)c2ccccc2)ccc1OC |
| InChI | InChI=1S/C21H28N2O6S2/c1-27-12-13-29-20-15-16(9-10-19(20)28-2)22-21(24)18(11-14-30-3)23-31(25,26)17-7-5-4-6-8-17/h4-10,15,18,23H,11-14H2,1-3H3,(H,22,24) |
| InChIKey | GAKLQJJVBMFSQB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|