C22H29N3O6S2 — CID 55348608
N-[1-[2-(3-methoxy-4-propan-2-yloxybenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzenesulfonamide (PubChem CID 55348608) has the molecular formula C22H29N3O6S2 and a molecular weight of 495.62 g/mol. Its IUPAC name is N-[1-[2-(3-methoxy-4-propan-2-yloxybenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzenesulfonamide.
| Compound Name | N-[1-[2-(3-methoxy-4-propan-2-yloxybenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 55348608 |
| Molecular Formula | C22H29N3O6S2 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | N-[1-[2-(3-methoxy-4-propan-2-yloxybenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzenesulfonamide |
| SMILES | COc1cc(C(=O)NNC(=O)C(CCSC)NS(=O)(=O)c2ccccc2)ccc1OC(C)C |
| InChI | InChI=1S/C22H29N3O6S2/c1-15(2)31-19-11-10-16(14-20(19)30-3)21(26)23-24-22(27)18(12-13-32-4)25-33(28,29)17-8-6-5-7-9-17/h5-11,14-15,18,25H,12-13H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | IRKWOBBPZBOULT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|