C20H23N3O8S — CID 55928308
[2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] (2S)-2-(benzenesulfonamido)propanoate (PubChem CID 55928308) has the molecular formula C20H23N3O8S and a molecular weight of 465.48 g/mol. Its IUPAC name is [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] (2S)-2-(benzenesulfonamido)propanoate.
| Compound Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] (2S)-2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 55928308 |
| Molecular Formula | C20H23N3O8S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] (2S)-2-(benzenesulfonamido)propanoate |
| SMILES | COc1ccc(C(=O)NNC(=O)COC(=O)[C@H](C)NS(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C20H23N3O8S/c1-13(23-32(27,28)15-7-5-4-6-8-15)20(26)31-12-18(24)21-22-19(25)14-9-10-16(29-2)17(11-14)30-3/h4-11,13,23H,12H2,1-3H3,(H,21,24)(H,22,25)/t13-/m0/s1 |
| InChIKey | FIHHTGCZDPLQAN-ZDUSSCGKSA-N |
| XLogP | 0.38 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|