C20H24N2O6S — CID 55927410
[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] (2S)-2-(benzenesulfonamido)propanoate (PubChem CID 55927410) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] (2S)-2-(benzenesulfonamido)propanoate.
| Compound Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] (2S)-2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 55927410 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] (2S)-2-(benzenesulfonamido)propanoate |
| SMILES | COc1ccc(CCNC(=O)COC(=O)[C@H](C)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O6S/c1-15(22-29(25,26)18-6-4-3-5-7-18)20(24)28-14-19(23)21-13-12-16-8-10-17(27-2)11-9-16/h3-11,15,22H,12-14H2,1-2H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | DFKYYYWDPGOUGU-HNNXBMFYSA-N |
| XLogP | 1.26 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |