C20H23NO5 — CID 8791419
[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] (2R)-2-phenoxypropanoate (PubChem CID 8791419) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] (2R)-2-phenoxypropanoate.
| Compound Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] (2R)-2-phenoxypropanoate |
|---|---|
| PubChem CID | 8791419 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] (2R)-2-phenoxypropanoate |
| SMILES | COc1ccc(CCNC(=O)COC(=O)[C@@H](C)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO5/c1-15(26-18-6-4-3-5-7-18)20(23)25-14-19(22)21-13-12-16-8-10-17(24-2)11-9-16/h3-11,15H,12-14H2,1-2H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | BNCYHGPANBAQNL-OAHLLOKOSA-N |
| XLogP | 2.36 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |