C20H22ClNO5 — CID 8867295
[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] (2S)-2-(4-chlorophenoxy)propanoate (PubChem CID 8867295) has the molecular formula C20H22ClNO5 and a molecular weight of 391.85 g/mol. Its IUPAC name is [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] (2S)-2-(4-chlorophenoxy)propanoate.
| Compound Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] (2S)-2-(4-chlorophenoxy)propanoate |
|---|---|
| PubChem CID | 8867295 |
| Molecular Formula | C20H22ClNO5 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] (2S)-2-(4-chlorophenoxy)propanoate |
| SMILES | COc1ccc(CCNC(=O)COC(=O)[C@H](C)Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H22ClNO5/c1-14(27-18-9-5-16(21)6-10-18)20(24)26-13-19(23)22-12-11-15-3-7-17(25-2)8-4-15/h3-10,14H,11-13H2,1-2H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | AGIJZWYOCXFALD-AWEZNQCLSA-N |
| XLogP | 3.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |