C21H23Cl2NO3 — CID 7209221
[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 7209221) has the molecular formula C21H23Cl2NO3 and a molecular weight of 408.33 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7209221 |
| Molecular Formula | C21H23Cl2NO3 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(C)[C@H](C(=O)OCC(=O)NCCc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23Cl2NO3/c1-14(2)20(16-5-9-18(23)10-6-16)21(26)27-13-19(25)24-12-11-15-3-7-17(22)8-4-15/h3-10,14,20H,11-13H2,1-2H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | YPNDXVZPLPCKSU-FQEVSTJZSA-N |
| XLogP | 4.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |