C18H21Cl2N2O+ — CID 9336451
[(1R)-1-(4-chlorophenyl)ethyl]-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl]azanium (PubChem CID 9336451) has the molecular formula C18H21Cl2N2O+ and a molecular weight of 352.29 g/mol. Its IUPAC name is [(1R)-1-(4-chlorophenyl)ethyl]-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(4-chlorophenyl)ethyl]-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9336451 |
| Molecular Formula | C18H21Cl2N2O+ |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | [(1R)-1-(4-chlorophenyl)ethyl]-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)NCCc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20Cl2N2O/c1-13(15-4-8-17(20)9-5-15)22-12-18(23)21-11-10-14-2-6-16(19)7-3-14/h2-9,13,22H,10-12H2,1H3,(H,21,23)/p+1/t13-/m1/s1 |
| InChIKey | PGPQOYLAKLEVEJ-CYBMUJFWSA-O |
| XLogP | 2.98 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |