C25H25NO5 — CID 9140643
[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-phenylphenoxy)acetate (PubChem CID 9140643) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-phenylphenoxy)acetate.
| Compound Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-phenylphenoxy)acetate |
|---|---|
| PubChem CID | 9140643 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-phenylphenoxy)acetate |
| SMILES | COc1ccc(CCNC(=O)COC(=O)COc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H25NO5/c1-29-22-11-7-19(8-12-22)15-16-26-24(27)17-31-25(28)18-30-23-13-9-21(10-14-23)20-5-3-2-4-6-20/h2-14H,15-18H2,1H3,(H,26,27) |
| InChIKey | OLYXVZJKEMOBNW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |