C20H23NO6 — CID 8913578
[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(2-methoxyphenoxy)acetate (PubChem CID 8913578) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(2-methoxyphenoxy)acetate.
| Compound Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 8913578 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(2-methoxyphenoxy)acetate |
| SMILES | COc1ccc(CCNC(=O)COC(=O)COc2ccccc2OC)cc1 |
| InChI | InChI=1S/C20H23NO6/c1-24-16-9-7-15(8-10-16)11-12-21-19(22)13-27-20(23)14-26-18-6-4-3-5-17(18)25-2/h3-10H,11-14H2,1-2H3,(H,21,22) |
| InChIKey | BYLCNSKSNWJJRS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |