C18H19N3O5 — CID 3538521
N'-[2-(benzylideneamino)oxyacetyl]-3,4-dimethoxybenzohydrazide (PubChem CID 3538521) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is N'-[2-(benzylideneamino)oxyacetyl]-3,4-dimethoxybenzohydrazide.
| Compound Name | N'-[2-(benzylideneamino)oxyacetyl]-3,4-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 3538521 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N'-[2-(benzylideneamino)oxyacetyl]-3,4-dimethoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CON=Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C18H19N3O5/c1-24-15-9-8-14(10-16(15)25-2)18(23)21-20-17(22)12-26-19-11-13-6-4-3-5-7-13/h3-11H,12H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | HOSJQQXWNMAEKR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|