C17H18N2O4S — CID 3283240
3,4-dimethoxy-N'-(2-phenylsulfanylacetyl)benzohydrazide (PubChem CID 3283240) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 3,4-dimethoxy-N'-(2-phenylsulfanylacetyl)benzohydrazide.
| Compound Name | 3,4-dimethoxy-N'-(2-phenylsulfanylacetyl)benzohydrazide |
|---|---|
| PubChem CID | 3283240 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 3,4-dimethoxy-N'-(2-phenylsulfanylacetyl)benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CSc2ccccc2)cc1OC |
| InChI | InChI=1S/C17H18N2O4S/c1-22-14-9-8-12(10-15(14)23-2)17(21)19-18-16(20)11-24-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | LYCRRVCHJQBPBC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|