C18H18F2N2O4S — CID 7970230
4-(difluoromethoxy)-3-methoxy-N'-[2-(4-methylphenyl)sulfanylacetyl]benzohydrazide (PubChem CID 7970230) has the molecular formula C18H18F2N2O4S and a molecular weight of 396.42 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-methoxy-N'-[2-(4-methylphenyl)sulfanylacetyl]benzohydrazide.
| Compound Name | 4-(difluoromethoxy)-3-methoxy-N'-[2-(4-methylphenyl)sulfanylacetyl]benzohydrazide |
|---|---|
| PubChem CID | 7970230 |
| Molecular Formula | C18H18F2N2O4S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 4-(difluoromethoxy)-3-methoxy-N'-[2-(4-methylphenyl)sulfanylacetyl]benzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)CSc2ccc(C)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C18H18F2N2O4S/c1-11-3-6-13(7-4-11)27-10-16(23)21-22-17(24)12-5-8-14(26-18(19)20)15(9-12)25-2/h3-9,18H,10H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | TZPWNHCGEAEKFY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|