C17H15ClF2N2O4 — CID 26657660
N'-[2-(4-chlorophenyl)acetyl]-4-(difluoromethoxy)-3-methoxybenzohydrazide (PubChem CID 26657660) has the molecular formula C17H15ClF2N2O4 and a molecular weight of 384.77 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)acetyl]-4-(difluoromethoxy)-3-methoxybenzohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)acetyl]-4-(difluoromethoxy)-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 26657660 |
| Molecular Formula | C17H15ClF2N2O4 |
| Molecular Weight | 384.77 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N'-[2-(4-chlorophenyl)acetyl]-4-(difluoromethoxy)-3-methoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)Cc2ccc(Cl)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C17H15ClF2N2O4/c1-25-14-9-11(4-7-13(14)26-17(19)20)16(24)22-21-15(23)8-10-2-5-12(18)6-3-10/h2-7,9,17H,8H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | VXWNVSKHIQOSRP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.77 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|